There are two naturally occurring isotopes of uranium. Uranium-238 and uranium-235. Uranium-238 has a percent abundance of 99.7% uranium-235 had a percent abundance of 0.3%. What is the atomic mass of uranium?

When the pressure is 0.72 atm, the temperature in Kelvin is 156 K.

To determine the Kelvin temperature when the pressure is 0.72 atm, you will need to use the trendline equation given in Fig 6.2. First, find the equation of the trendline by using the graph's two points, (300 K, 1 atm) and (500 K, 2 atm).

The equation for the trendline is:

y = mx + b

Where y is pressure, x is the temperature in Kelvin, m is the slope, and b is the y-intercept. We can find the slope of the trendline by using the two points provided in the graph:

Slope (m) = (y2 - y1) / (x2 - x1)

Slope = (2 atm - 1 atm) / (500 K - 300 K)

Slope = 0.005 atm/K

The equation for the trendline can now be written: y = 0.005x + b. To find the y-intercept, b, we can use one of the two points: Solving for b:

1 atm = 0.005(300 K) + bb = 1.5 atm

Now we can use the equation for the trendline to find the temperature (x) at which the pressure (y) equals 0.72 atm:

0.72 atm = 0.005x + 1.5 atm

0.72 atm - 1.5 atm = 0.005x

-0.78 atm = 0.005xx

= -0.78 atm / 0.005x

= 156K

To learn more about Pressure :

https://brainly.com/question/24719118

#SPJ11

Equation for pentane's balanced combustion: C5H12(l) + 8 O2(g) 5 CO2(g) + 6 H2O ( g)

For more information on combustion kindly visit to

https://brainly.com/question/15117038

#SPJ1

To determine the Cl for NeMutl:Wt, you need to use the data from part 2 of the case study. The data is given as 1x10-10 for the Wt strain and 1x10-7 for the mutant strain. To calculate the Cl, we use the following equation: Cl = 1/[(1/ID50) - (1/LD50)]. Using this equation, we can calculate the Cl to be 3x10-3.

To determine the Cl for NeMut2:Wt, we can use the same equation. Using the data from the table in part B, the Cl for NeMut2:Wt can be calculated to be 8x10-3.Interpreting these results, we can see that NeMut1:Wt has a Cl that is roughly 3 times lower than that of NeMut2:Wt. This suggests that the mutation of NeMut1 is significantly affecting a virulence factor, while NeMut2 may not be affecting a virulence factor as significantly.

It is important to note that similar LD50 and/or ID50 values of a Wt and mutant strain does not necessarily mean that the mutation does not affect a virulence factor. This is because the LD50 and ID50 values are used to measure how much of the pathogen is needed to produce a certain effect, but other aspects of the pathogen such as the speed or rate of infection or the amount of toxin produced can still be different and affect the virulence of the strain.

Cl for NeMut1:Wt cannot be calculated from the data presented in part 2 of the case study. The given results are:|  Inoculum (LD50) |  Mortality (LD50) |  CFU/ml of blood | Wild-type   | 6.5 × 10−7    |  6.5 × 10−7      | 7.0 × 103 | NeMut1  | 1.0 × 10−10    |  6.5 × 10−7     | 3.0 × 105 | NeMut2  | 2.0 × 10−7    |  2.0 × 10−7     | 2.2 × 103 |Since the Cl cannot be calculated from the data given, the correct option is (d) Cl cannot be calculated from the data given.If the LDs0 and/or IDs0 values of a Wt and mutant strain are similar in this type of experiment, it does not necessarily mean that the mutation does not affect a virulence factor.

This is because mutations can affect different aspects of virulence, and the specific virulence factor being measured may not be impacted by the mutation.In order to determine the CI for NeMut1:Wt and NeMut2:Wt, we need to use the following formula:CI = (output ratio of mutant) / (output ratio of wild-type)Output ratio = (CFU/ml of blood) / (inoculum)Using the data from the table, we get:

Output ratio of NeMut1:Wt = 3.0 × 105 / 1.0 × 10−10 = 3.0 × 1015Output ratio of wild-type = 7.0 × 103 / 6.5 × 10−7 = 1.1 × 1010CI of NeMut1:Wt = (3.0 × 1015) / (1.1 × 1010) = 2.7 × 105Output ratio of NeMut2:Wt = 2.2 × 103 / 2.0 × 10−7 = 1.1 × 1010CI of NeMut2:Wt = (1.1 × 1010) / (1.1 × 1010) = 1Interpretation of results from question 5 above: The CI of NeMut1:Wt is much greater than 1, indicating that NeMut1 is more virulent than the wild-type strain. The CI of NeMut2:Wt is equal to 1, indicating that NeMut2 does not exhibit any significant difference in virulence compared to the wild-type strain.

For more such questions on mutant

https://brainly.com/question/17031191

#SPJ11

Answer:

C

,

,

,

,

,

,

,

,

,

,

,

,

,

,,

,

,

When a particle undergoes beta decay, its atomic number increases by one.

The balanced equation of the  beta decay of uranium-235 is given below:

²³⁵₉₂U ---> ⁰₋₁e + ²³⁵₉₃Np

Beta decay is a type of radioactive decay that occurs when a nucleus emits a beta particle, which is an electron or a positron. During beta decay, a neutron or a proton inside the nucleus is transformed into the opposite type of particle.

In beta minus decay, a neutron in the nucleus is transformed into a proton, which remains in the nucleus, while an electron and an antineutrino are emitted. The electron is known as a beta particle.

In beta plus decay, also called positron emission, a proton in the nucleus is transformed into a neutron, which remains in the nucleus, while a positron and a neutrino are emitted. The positron is also known as a beta particle, but it has a positive charge.

Learn more about beta decay at: https://brainly.com/question/13174032

#SPJ1

Answer- Incomplete combustions of alkanes are dangerous as it leads to  toxic gases such as carbon monoxide man odorless,colorless and highly poisonous gas to be released in the air

Environmental impacts of burning fossil fuels such as alkanes can have a massive impact of global warming in which heat is prevented from the leaving the atmosphere due to a build-up of carbon dioxide ad other compounds, collectively known as greenhouse gases. In order to make these impacts less severe scientists have found alternative fuels, such as biofuels and biodiesels, this can reduce the risk of harm to the world as alternative fuels produce less CO2 and air pollutants then others that run on petrol and diesel

Since the electronic configuration of nitrogen is 1s² 2s² 2p³, the number of electrons present in the nitrogen atom is 7, and the atomic number of nitrogen is also seven (7).

The atomic number of an atom is the number of protons in the nucleus of an atom. The number of protons defines the properties of an element. For example, if an element with 5 protons is boron atom.

The electronic configuration of an atom represents the number of electrons in each sub-energy level of the atom in the ground state.

The electronic configuration of nitrogen is 1s²2s²2p³. As you know, the electrons around the nucleus are located in energies or levels. Therefore, from the definition of electron configuration, we can say that the nitrogen atom has 2 electrons in the first energy level K of the s-subshell, and in the s-subshell and the p subshell of the second energy level L, respectively There are 2 or 3 electrons.

Therefore, the total number of electrons in the nitrogen atom is 7 (2 + 2 + 3). We know that the number of protons = the number of electrons, so the number of protons in the nitrogen nucleus is 7. Therefore, the nitrogen atom has an atomic number of 7.

For more information about electronic configuration, visit :

https://brainly.com/question/21977349

#SPJ4

The possible e₁ product of the given reaction is given below in the  image format.

Alkene products are produced in mixes via the elimination process. According to Zaitsev's rule, base-induced elimination results in the primary alkene product being the more strongly substituted double bond.

An chemical process known as a unimolecular elimination (E1) produces a double bond by removing an H-X substituent from an organic molecule. Because the creation of the carbocation intermediate (similar to an SN1 reaction) from simply the X substituent departing on its own is the reaction's rate-limiting step, it is unimolecular in nature:

A two-step process called an E1 elimination reaction uses a carbocation intermediate:

The elimination of the departing group is the mechanism's initial phase. In this instance, the bromine is the departing group.

The removal of a proton and creation of a double bond constitute the mechanism's second stage. The three substituents on the carbocation in this instance are all equivalent. The mechanism is demonstrated below:

Learn more about E1 products:

https://brainly.com/question/29490944

#SPJ4

The mass of benzene that should be dissolved in 425g of water at 35°C to produce a solution with a vapor pressure of 36.1 mmHg is approximately 10.02 g.

1. Calculate the mole fraction of benzene (Xbenzene) in the solution using the following equation:

Ptotal = Xbenzene x P0benzene + Xwater x P0water

where Ptotal is the total vapor pressure of the solution, P0benzene is the vapor pressure of pure benzene, P0water is the vapor pressure of pure water, and Xwater = 1 - Xbenzene.

Rearranging the equation to solve for Xbenzene:

Xbenzene = (Ptotal - Xwater x P0water) / P0benzene

Substituting the given values:

Xbenzene = (36.1 mmHg - 0.953 x 42.2 mmHg) / 95.1 mmHg

Xbenzene = 0.390

2. Calculate the molality of the solution using the following equation:

molality = moles of solute / mass of solvent in kg

moles of solute = molality x mass of solvent in kg

Substituting the given values:

molality = 0.390 mol / kg

mass of solvent = 425 g = 0.425 kg

moles of solute = 0.390 mol / kg x 0.425 kg

moles of solute = 0.166 mol

3. Calculate the mass of benzene using its molar mass:

mass of benzene = moles of benzene x molar mass of benzene

Substituting the given values:

moles of benzene = 0.166 mol

molar mass of benzene = 78.11 g/mol

mass of benzene = 0.166 mol x 78.11 g/mol

mass of benzene = 12.97 g

However, we assumed that the density of the solution is equal to the density of water, which is not the case. Therefore, we need to adjust the mass of benzene by using the following equation:

mass of benzene = mass of solute / (1 - mass fraction of solute)

4. Calculate the mass fraction of benzene using the mole fraction:

mass fraction of benzene = (Xbenzene x molar mass of benzene) / (Xbenzene x molar mass of benzene + Xwater x molar mass of water)

5. Substituting the given values:

molar mass of water = 18.02 g/mol

mass fraction of benzene = (0.390 x 78.11 g/mol) / (0.390 x 78.11 g/mol + 0.610 x 18.02 g/mol)

mass fraction of benzene = 0.097

Substituting the values in the mass equation:

mass of benzene = 12.97 g / (1 - 0.097)

mass of benzene = 10.02 g

To know more about benzene, visit:

https://brainly.com/question/7284916

#SPJ1

The reaction starts with 0.200 M A and 0.250 M B, the equilibrium concentration of C.3.63x10⁻¹⁰ M.

Chemical equilibrium is the state in which both the reactants and the products of a reaction are at a concentration that does not change over time any longer. In this condition, the forward and backward reaction rates are equal.

2A(aq) + B(aq) <==> C(aq)

Equilibrium expression is

K = [C] / [A]2[B]

Prepare an ICE table:

2A(aq)  +  B(aq) <==>  C(aq)

0.2..........0.15...............0........Initial

-2x...........-x.................+x......Change

0.2-2x....0.15-x............x........Equilibrium

Substitute in the equilibrium expression:

1.10x10⁻⁴ = (x) / (0.2-2x)2(0.15-x)  ... b/c K is small, we can essentially avoid using the quadratic as follows..

1.1x10⁻⁴  = x/(0.2)2(0.15)

x = (2.2x10₋⁵) (1.65x10⁻⁵)

x = 3.63x10⁻¹⁰  M = [C]

To know more about equilibrium concentrations visit:

https://brainly.com/question/16645766

#SPJ1

Answer:

See below.

Explanation:

To determine the electron pair geometry of Carbonothioyl dibromide, we need to first draw its Lewis structure:

Br Br

\ /

C=S

/

Br Br

Carbonothioyl dibromide has four electron groups around the central sulfur atom: two single bonds with the two bromine atoms, one double bond with the carbon atom, and one lone pair of electrons on the sulfur atom.

Using VSEPR theory, we can predict the electron pair geometry by considering both the bonding and the lone pairs of electrons. In this case, the electron pair geometry of Carbonothioyl dibromide is tetrahedral because it has four electron groups around the central sulfur atom.

However, the molecular geometry of Carbonothioyl dibromide is trigonal pyramidal due to the presence of one lone pair of electrons on the sulfur atom.

The answer to this question is that blood flow to the skin does not increase; instead, it is directed inward to conserve heat.

The preoptic area of the hypothalamus serves as the body's thermostat, and when its temperature drops below the thermostat setting, a number of physiological processes are triggered. A) Shivering thermogenesis occurs, which is the production of heat by muscular contractions, B) Nonshivering thermogenesis occurs, which is the production of heat by increased metabolic activity in brown adipose tissue, C) Epinephrine levels rise to promote the mobilization of glucose from stored energy sources and D) Blood returning from the limbs is shunted to deep veins to conserve heat. However, the answer to this question is that blood flow to the skin does not increase; instead, it is directed inward to conserve heat.

For more such questions on  blood flow

https://brainly.com/question/28023997

#SPJ11

The volume ratios from the equation 2H2 + O2 → 2H2O are:

The coefficients in a balanced chemical equation give the ratio of moles of reactants and products. From the equation 2H2 + O2 → 2H2O, we can see that:

Therefore, the following volume ratios are valid:

What are the reactants?

The reactants are the substances that participate in a chemical reaction and are consumed to form new products. In the equation 2H2 + O2 → 2H2O, the reactants are hydrogen gas (H2) and oxygen gas (O2). These reactants undergo a chemical reaction to form water (H2O) as the product.

To know more about reactants, visit:

https://brainly.com/question/17096236

#SPJ1

Answer:

the answer is for surely C

Explanation:

you can tell from the way is made and I also have one in my room

If all is working correctly, the electron in a higher orbital or shell will have more energy than the electron in a lower orbital or shell. The following statement is correct: The electron that is farther away from the nucleus is at a higher energy level.

In order for the electron to escape from the atom, it must be excited, meaning that it must absorb energy. When this occurs, the electron moves to a higher energy level, which is farther from the nucleus. Because the electron is now in an excited state, it is more vulnerable to being released from the atom if additional energy is provided to it. According to Bohr's model of the atom, electrons revolve around the nucleus in circular orbits with varying energy levels. As the distance between the nucleus and the electron increases, so does the energy level of the electron. The energy of electrons in the first energy level is the lowest, and as the energy level increases, so does the energy of electrons. As a result, electrons in the outermost shell have the highest energy levels.

To learn more about Nucleus :

https://brainly.com/question/9651421

#SPJ11

Phenol, toluene, benzene, bromo benzene, and nitrobenzene are the chemicals in this order.

Due to the M effect, benzosulphonic acid is least reactive in an electrophilic aromatic substitution. Because nitrogen is more electronegative than carbon and functions as an electron withdrawing group, pyridine is less reactive than benzene towards electrophilic aromatic substitution. The meta hydrogen is thus replaced.

Most beginning organic chemistry courses cover six fundamental electrophilic aromatic substitution reactions: chlorination, bromination, nitration, sulfonation, Friedel-Crafts alkylation, and Friedel-Crafts acylation.

To know more about nitrobenzene visit:-

brainly.com/question/13190784

#SPJ1

Answer:

First, we need to calculate the change in temperature:

ΔT = final temperature - initial temperature

ΔT = 85 °C - 35 °C

ΔT = 50 °C

Next, we can use the following formula to calculate the heat energy required:

Q = m·C·ΔT

where Q is the heat energy in calories, m is the mass of the sample in grams, C is the specific heat in cal/g °C, and ΔT is the change in temperature in °C.

Plugging in the given values, we get:

Q = 35.0 g · 0.108 cal/g °C · 50 °C

Q = 189.0 calories

Therefore, 189.0 calories are required to raise the temperature of the sample from 35 °C to 85 °C

Answer: 1:1

Explanation:

Since Na trades place with Na it makes it 1:1

The precision of the measurement is very good, measurements are within a very small range of each other. the accuracy of the measurement is not as good since the average measurement was 1.974g while the true mass was 1.975g.

Precision and accuracy are two important concepts in measurement. Precision is the degree of reproducibility or agreement of a set of measurements. It is usually expressed as the standard deviation of a set of measurements or the coefficient of variation. Accuracy is the degree of closeness to the true or accepted value of a measurement.

It is usually expressed as the difference between the measured value and the true or accepted value.

Learn more about precision and accuracy here:

https://brainly.com/question/5792909

#SPJ1

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

The substance with the greatest solubility in water is Ag2SO4, with a Ksp of 1.5 x 10-5.

The solubility of a substance is determined by its solubility product constant (Ksp). The higher the Ksp value, the more soluble the substance is in water.

Ksp is the equilibrium constant for a slightly soluble salt in a saturated solution. It is used to calculate the maximum concentration of ions in a solution at equilibrium. When a solid salt dissolves in water, it dissociates into its constituent ions.

The given values of Ksp for the substances are as follows:

BaF2, Kp = 1.5 x 10^-6

Ca(OH)2, Ksp - 6.5 x 10^-6

SrCros. Ksp = 2.2 x 10^-5

Ag2SO4, Ksp - 1.5 x 10^-5

Zn(103)2, Ksp = 3.9 x 10^-6

For more question on solubility click on

https://brainly.com/question/24057916

#SPJ11

Answer:

The dissociation of a monoprotic acid HA can be represented as follows:

HA ⇌ H+ + A-

The equilibrium constant expression for this reaction is:

Ka = [H+][A-]/[HA]

We are given the initial concentration of the acid (HA) as 0.48 M and the equilibrium concentration as 0.36 M. At equilibrium, the concentration of H+ and A- will also be 0.36 M.

Substituting the values into the equilibrium constant expression, we get:

Ka = (0.36)^2 / 0.48 = 0.27

Therefore, the value of Ka for the acid is 0.27, rounded to two significant figures.

The given reaction is classified as enamine hydrolysis. Enamine hydrolysis is a type of reaction that involves the hydrolysis of an imine group, leading to an aldehyde or ketone product. Option C.

The reaction proceeds by first forming an enamine intermediate by condensing an amine with an aldehyde or ketone, followed by an acid-catalyzed hydrolysis of the imine to produce a ketone or aldehyde product. The reaction can also be catalyzed by a base, although this is less common.
In the given reaction, an imine is hydrolyzed, resulting in an aldehyde or ketone product. The imine is formed when an amine reacts with an aldehyde or ketone, and the reaction of the imine with water is catalyzed by an acid. This reaction is known as enamine hydrolysis. Option C.

For more such questions on hydrolysis

https://brainly.com/question/31184126

#SPJ11

According to the Bronsted-Lowry concept of acids and bases, the statement "If a base is strong, then its conjugate acid will be relatively weaker" is NOT true.

The Bronsted-Lowry concept defines an acid as a proton (H+) donor and a base as a proton acceptor. The strength of an acid or base is determined by the extent to which it is willing to donate or accept a proton. Therefore, when a strong acid donates a proton, the resulting conjugate base is also strong; likewise, when a strong base accepts a proton, the resulting conjugate acid is also strong.
Other characteristics of bases include the presence of a hydroxide group (OH-), and the ability to accept a proton (H+) to form a salt. However, the strength of a base does not necessarily depend on its presence or absence of a hydroxide group.
In conclusion, the Bronsted-Lowry concept of acids and bases states that the strength of a base does not determine the strength of its conjugate acid; therefore, the statement "If a base is strong, then its conjugate acid will be relatively weaker" is NOT true.

For more such questions on Bronsted-Lowry

https://brainly.com/question/24098522

#SPJ11

The SI unit of pressure is the Pascal (Pa).

The boiling point of water is lower on Mount McKinley than the boiling point of water in NYC.

What is Pressure?

Pressure is defined as the amount of force applied perpendicular to the surface of an object per unit area over which that force is distributed. In other words, it is the force per unit area that an object exerts on another object. Pressure can be measured in various units such as pascal (Pa), bar, pounds per square inch (psi), and atmospheres (atm), among others. It is an important concept in physics and is used to describe many phenomena, including fluid dynamics, weather patterns, and even the behavior of gases in space.

At lower elevations, atmospheric pressure is higher compared to higher elevations.

Standard atmosphere or standard atmospheric pressure is equal to 101325 Pa.

Learn more about Pressure from given link

https://brainly.com/question/28012687

#SPJ1

If the sample of the inhalation anesthetic gas Halothane, in a 500-mL cylinder has a pressure of 2.3, the pressure is given as 2.6 atm

We have the following data to solve the problem with

p1 = 2.3 atm

T1 = 273 K

P2 is unknown

T2 = 273 + 37

= 310 K

To solve further we would have to use the Third gas law. The third gas law or the Gay-Lussacs law tells us that

P1 / T1 = P2 / T2

We would have to put in the values in the formula that we have above

[tex]\frac{2.3 atm}{273K} = \frac{p2}{310}[/tex]

from here would cross multiply

310 * 2.3 = p2 * 273

divide through by 273

713 / 273

P2 = 2.61

The pressure is given as 2.61

Read more on pressure here:https://brainly.com/question/25736513

#SPJ1

Answer: 468.8m

Explanation:

640kHz x 1000Hz/1kHz = 6.4x10^5 Hz

λ=c/v

3.00x10^8m/s / 6.4x10^5s = 468.75m

It's a negative value for ∆H°, indicating that the conversion of diamond to graphite releases energy. As a result, it is an exothermic reaction.

The conversion of diamond into graphite is exothermic. The enthalpy change of the reaction is -267.1 kJ.There are three reactions that take place in this process. Cdiamond (s) + O2 (g) → CO2(g) ∆H° = -395.4 kJ2 CO2 (g) → 2 CO(g)+O2 (g) ∆H° = 566.0 kJ2 CO2(g) → Cgraphite(s) + CO2 (g) ∆H° =-172.5 kJCdiamond (s) → Cgraphite (s) ∆H°= ?

The conversion of diamond to graphite is an endothermic process. It has a positive value of ∆H°. Therefore, the heat is absorbed by the surroundings. According to the first two reactions, the formation of CO and CO2 from the combustion of diamonds produces energy.

The net reaction for the conversion of diamond to graphite takes place as follows:

Diamond (s) + 2 O2(g) → Cgraphite (s) + 2 CO2 (g)

The energy change for this reaction can be determined by combining the above three reactions. The enthalpy change is obtained by subtracting the sum of the enthalpies of the reactants from the sum of the enthalpies of the products. The enthalpy change of the reaction is calculated as follows:

∆H°=ΣH°(products)−ΣH°(reactants)

∆H°=(−172.5)+(2×−393.5)+(566.0)−[(0)+(0)+(-395.4)+(2×0)]

∆H°=−267.1 kJ

To learn more about Exothermic reaction :

https://brainly.com/question/2924714

#SPJ11